C11H8Cl2F3NO3 — CID 78990430
2-[(2,5-dichlorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 78990430) has the molecular formula C11H8Cl2F3NO3 and a molecular weight of 330.09 g/mol. Its IUPAC name is 2-[(2,5-dichlorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(2,5-dichlorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 78990430 |
| Molecular Formula | C11H8Cl2F3NO3 |
| Molecular Weight | 330.09 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-[(2,5-dichlorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H8Cl2F3NO3/c12-6-1-2-8(13)7(3-6)10(20)17(4-9(18)19)5-11(14,15)16/h1-3H,4-5H2,(H,18,19) |
| InChIKey | UVYAJYPOKROTPY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.09 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |