2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid

C11H9F4NO3 — CID 78990578

IUPAC2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid
SMILESO=C(O)CN(CC(F)(F)F)C(=O)c1ccccc1F
InChIInChI=1S/C11H9F4NO3/c12-8-4-2-1-3-7(8)10(19)16(5-9(17)18)6-11(13,14)15/h1-4H,5-6H2,(H,17,18)
InChIKeyDIIAJDSCDBRXCC-UHFFFAOYSA-N
MW279.19 g/mol
LogP1.91
Rot. Bonds4

About 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid

2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 78990578) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid
PubChem CID78990578
Molecular FormulaC11H9F4NO3
Molecular Weight279.19 g/mol
Exact Mass279.05
IUPAC Name2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid
SMILESO=C(O)CN(CC(F)(F)F)C(=O)c1ccccc1F
InChIInChI=1S/C11H9F4NO3/c12-8-4-2-1-3-7(8)10(19)16(5-9(17)18)6-11(13,14)15/h1-4H,5-6H2,(H,17,18)
InChIKeyDIIAJDSCDBRXCC-UHFFFAOYSA-N
XLogP1.91
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.19
LogP ≤ 51.91
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The IUPAC name of 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (CID 78990578) is 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
What is the SMILES notation for 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The canonical SMILES for 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid is O=C(O)CN(CC(F)(F)F)C(=O)c1ccccc1F.
What is the InChIKey of 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid?
The InChIKey is DIIAJDSCDBRXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9F4NO3/c12-8-4-2-1-3-7(8)10(19)16(5-9(17)18)6-11(13,14)15/h1-4H,5-6H2,(H,17,18).
What are the key properties of 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid?
2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid has a molecular weight of 279.19 g/mol, XLogP of 1.91, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid is sourced from PubChem (CID 78990578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).