C11H9F4NO3 — CID 78990578
2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid (PubChem CID 78990578) has the molecular formula C11H9F4NO3 and a molecular weight of 279.19 g/mol. Its IUPAC name is 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid.
| Compound Name | 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
|---|---|
| PubChem CID | 78990578 |
| Molecular Formula | C11H9F4NO3 |
| Molecular Weight | 279.19 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 2-[(2-fluorobenzoyl)-(2,2,2-trifluoroethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC(F)(F)F)C(=O)c1ccccc1F |
| InChI | InChI=1S/C11H9F4NO3/c12-8-4-2-1-3-7(8)10(19)16(5-9(17)18)6-11(13,14)15/h1-4H,5-6H2,(H,17,18) |
| InChIKey | DIIAJDSCDBRXCC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.19 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |