About 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane
6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane (PubChem CID 143019170) has the molecular formula C19H38ClN3O3
and a molecular weight of 391.98 g/mol. Its IUPAC name is 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane.
Molecular Properties
| Compound Name | 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane |
| PubChem CID | 143019170 |
| Molecular Formula | C19H38ClN3O3 |
| Molecular Weight | 391.98 g/mol |
| Exact Mass | 391.26 |
| IUPAC Name | 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane |
| SMILES | CC.CC.CC.CC.COCC(=O)N(C)N(C)C(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C11H14ClN3O3.4C2H6/c1-14(10(16)7-18-3)15(2)11(17)8-4-5-9(12)13-6-8;4*1-2/h4-6H,7H2,1-3H3;4*1-2H3 |
| InChIKey | QWJDLFYEVWWVCQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.98 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane?
The IUPAC name of 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane (CID 143019170) is 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane.
What is the SMILES notation for 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane?
The canonical SMILES for 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane is CC.CC.CC.CC.COCC(=O)N(C)N(C)C(=O)c1ccc(Cl)nc1.
What is the InChIKey of 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane?
The InChIKey is QWJDLFYEVWWVCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14ClN3O3.4C2H6/c1-14(10(16)7-18-3)15(2)11(17)8-4-5-9(12)13-6-8;4*1-2/h4-6H,7H2,1-3H3;4*1-2H3.
What are the key properties of 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane?
6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane has a molecular weight of 391.98 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N'-(2-methoxyacetyl)-N,N'-dimethylpyridine-3-carbohydrazide;ethane is sourced from PubChem (CID 143019170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).