C10H13ClN2O — CID 71036305
1-(6-amino-5-chloro-3-pyridinyl)-2,2-dimethylpropan-1-one (PubChem CID 71036305) has the molecular formula C10H13ClN2O and a molecular weight of 212.68 g/mol. Its IUPAC name is 1-(6-amino-5-chloro-3-pyridinyl)-2,2-dimethylpropan-1-one.
| Compound Name | 1-(6-amino-5-chloro-3-pyridinyl)-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 71036305 |
| Molecular Formula | C10H13ClN2O |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-(6-amino-5-chloro-3-pyridinyl)-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)c1cnc(N)c(Cl)c1 |
| InChI | InChI=1S/C10H13ClN2O/c1-10(2,3)8(14)6-4-7(11)9(12)13-5-6/h4-5H,1-3H3,(H2,12,13) |
| InChIKey | ILZLRLAJPASFAW-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |