C6H6ClN3O2 — CID 130615065
6-amino-5-chloro-N-hydroxypyridine-3-carboxamide (PubChem CID 130615065) has the molecular formula C6H6ClN3O2 and a molecular weight of 187.59 g/mol. Its IUPAC name is 6-amino-5-chloro-N-hydroxypyridine-3-carboxamide.
| Compound Name | 6-amino-5-chloro-N-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 130615065 |
| Molecular Formula | C6H6ClN3O2 |
| Molecular Weight | 187.59 g/mol |
| Exact Mass | 187.01 |
| IUPAC Name | 6-amino-5-chloro-N-hydroxypyridine-3-carboxamide |
| SMILES | Nc1ncc(C(=O)NO)cc1Cl |
| InChI | InChI=1S/C6H6ClN3O2/c7-4-1-3(6(11)10-12)2-9-5(4)8/h1-2,12H,(H2,8,9)(H,10,11) |
| InChIKey | WZBAFHLGJRIKKW-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.59 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|