C8H8Cl2N2O2 — CID 130956892
4-amino-3,5-dichloro-N-hydroxy-N-methylbenzamide (PubChem CID 130956892) has the molecular formula C8H8Cl2N2O2 and a molecular weight of 235.07 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-hydroxy-N-methylbenzamide.
| Compound Name | 4-amino-3,5-dichloro-N-hydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 130956892 |
| Molecular Formula | C8H8Cl2N2O2 |
| Molecular Weight | 235.07 g/mol |
| Exact Mass | 234.00 |
| IUPAC Name | 4-amino-3,5-dichloro-N-hydroxy-N-methylbenzamide |
| SMILES | CN(O)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C8H8Cl2N2O2/c1-12(14)8(13)4-2-5(9)7(11)6(10)3-4/h2-3,14H,11H2,1H3 |
| InChIKey | SXKDLSPDJZUZBE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.07 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|