C16H15N3O2 — CID 102712568
N-(2,6-dimethyl-3-pyridinyl)-2-oxo-1,3-dihydroindole-6-carboxamide (PubChem CID 102712568) has the molecular formula C16H15N3O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is N-(2,6-dimethyl-3-pyridinyl)-2-oxo-1,3-dihydroindole-6-carboxamide.
| Compound Name | N-(2,6-dimethyl-3-pyridinyl)-2-oxo-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102712568 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | N-(2,6-dimethyl-3-pyridinyl)-2-oxo-1,3-dihydroindole-6-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccc3c(c2)NC(=O)C3)c(C)n1 |
| InChI | InChI=1S/C16H15N3O2/c1-9-3-6-13(10(2)17-9)19-16(21)12-5-4-11-8-15(20)18-14(11)7-12/h3-7H,8H2,1-2H3,(H,18,20)(H,19,21) |
| InChIKey | HKZUMRXUFRXHQN-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |