C12H9N5O2 — CID 102712844
2-oxo-N-(1,2,4-triazin-3-yl)-1,3-dihydroindole-6-carboxamide (PubChem CID 102712844) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-oxo-N-(1,2,4-triazin-3-yl)-1,3-dihydroindole-6-carboxamide.
| Compound Name | 2-oxo-N-(1,2,4-triazin-3-yl)-1,3-dihydroindole-6-carboxamide |
|---|---|
| PubChem CID | 102712844 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-oxo-N-(1,2,4-triazin-3-yl)-1,3-dihydroindole-6-carboxamide |
| SMILES | O=C1Cc2ccc(C(=O)Nc3nccnn3)cc2N1 |
| InChI | InChI=1S/C12H9N5O2/c18-10-6-7-1-2-8(5-9(7)15-10)11(19)16-12-13-3-4-14-17-12/h1-5H,6H2,(H,15,18)(H,13,16,17,19) |
| InChIKey | YTYXMPSBPXGHCH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |