C17H11F2N3O2 — CID 166209295
4,7-difluoro-N-(2-oxo-1,3-dihydroindol-5-yl)-1H-indole-2-carboxamide (PubChem CID 166209295) has the molecular formula C17H11F2N3O2 and a molecular weight of 327.29 g/mol. Its IUPAC name is 4,7-difluoro-N-(2-oxo-1,3-dihydroindol-5-yl)-1H-indole-2-carboxamide.
| Compound Name | 4,7-difluoro-N-(2-oxo-1,3-dihydroindol-5-yl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 166209295 |
| Molecular Formula | C17H11F2N3O2 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4,7-difluoro-N-(2-oxo-1,3-dihydroindol-5-yl)-1H-indole-2-carboxamide |
| SMILES | O=C1Cc2cc(NC(=O)c3cc4c(F)ccc(F)c4[nH]3)ccc2N1 |
| InChI | InChI=1S/C17H11F2N3O2/c18-11-2-3-12(19)16-10(11)7-14(22-16)17(24)20-9-1-4-13-8(5-9)6-15(23)21-13/h1-5,7,22H,6H2,(H,20,24)(H,21,23) |
| InChIKey | YSUWDMIPIYIWBU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |