C22H25F2N3O4 — CID 55483855
4-butoxy-N-[2-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide (PubChem CID 55483855) has the molecular formula C22H25F2N3O4 and a molecular weight of 433.46 g/mol. Its IUPAC name is 4-butoxy-N-[2-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide.
| Compound Name | 4-butoxy-N-[2-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 55483855 |
| Molecular Formula | C22H25F2N3O4 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 4-butoxy-N-[2-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NC(C(=O)NC)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C22H25F2N3O4/c1-3-4-11-31-16-8-5-14(6-9-16)21(29)26-13-19(28)27-20(22(30)25-2)15-7-10-17(23)18(24)12-15/h5-10,12,20H,3-4,11,13H2,1-2H3,(H,25,30)(H,26,29)(H,27,28) |
| InChIKey | LUTFAWXRDITYIG-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|