C20H20ClF2N3O3 — CID 55501712
4-chloro-N-[4-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-4-oxobutyl]benzamide (PubChem CID 55501712) has the molecular formula C20H20ClF2N3O3 and a molecular weight of 423.85 g/mol. Its IUPAC name is 4-chloro-N-[4-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 55501712 |
| Molecular Formula | C20H20ClF2N3O3 |
| Molecular Weight | 423.85 g/mol |
| Exact Mass | 423.12 |
| IUPAC Name | 4-chloro-N-[4-[[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]amino]-4-oxobutyl]benzamide |
| SMILES | CNC(=O)C(NC(=O)CCCNC(=O)c1ccc(Cl)cc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H20ClF2N3O3/c1-24-20(29)18(13-6-9-15(22)16(23)11-13)26-17(27)3-2-10-25-19(28)12-4-7-14(21)8-5-12/h4-9,11,18H,2-3,10H2,1H3,(H,24,29)(H,25,28)(H,26,27) |
| InChIKey | IQHDTZBLYIRLJS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.85 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|