C20H21ClF2N2O2 — CID 31350253
4-chloro-N-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]-methylamino]-4-oxobutyl]benzamide (PubChem CID 31350253) has the molecular formula C20H21ClF2N2O2 and a molecular weight of 394.85 g/mol. Its IUPAC name is 4-chloro-N-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]-methylamino]-4-oxobutyl]benzamide.
| Compound Name | 4-chloro-N-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]-methylamino]-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 31350253 |
| Molecular Formula | C20H21ClF2N2O2 |
| Molecular Weight | 394.85 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 4-chloro-N-[4-[[(1S)-1-(3,4-difluorophenyl)ethyl]-methylamino]-4-oxobutyl]benzamide |
| SMILES | C[C@@H](c1ccc(F)c(F)c1)N(C)C(=O)CCCNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClF2N2O2/c1-13(15-7-10-17(22)18(23)12-15)25(2)19(26)4-3-11-24-20(27)14-5-8-16(21)9-6-14/h5-10,12-13H,3-4,11H2,1-2H3,(H,24,27)/t13-/m0/s1 |
| InChIKey | BOOMCVKVNYQDQI-ZDUSSCGKSA-N |
| XLogP | 4.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.85 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|