C24H22F2N2O2 — CID 55509696
N-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]-2-oxoethyl]-4-phenylbenzamide (PubChem CID 55509696) has the molecular formula C24H22F2N2O2 and a molecular weight of 408.45 g/mol. Its IUPAC name is N-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]-2-oxoethyl]-4-phenylbenzamide.
| Compound Name | N-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]-2-oxoethyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 55509696 |
| Molecular Formula | C24H22F2N2O2 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N-[2-[1-(3,4-difluorophenyl)ethyl-methylamino]-2-oxoethyl]-4-phenylbenzamide |
| SMILES | CC(c1ccc(F)c(F)c1)N(C)C(=O)CNC(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22F2N2O2/c1-16(20-12-13-21(25)22(26)14-20)28(2)23(29)15-27-24(30)19-10-8-18(9-11-19)17-6-4-3-5-7-17/h3-14,16H,15H2,1-2H3,(H,27,30) |
| InChIKey | IEBKIQXLVJHJJL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |