C19H19BrF2N2O3 — CID 55790503
4-(2-bromophenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide (PubChem CID 55790503) has the molecular formula C19H19BrF2N2O3 and a molecular weight of 441.27 g/mol. Its IUPAC name is 4-(2-bromophenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide.
| Compound Name | 4-(2-bromophenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 55790503 |
| Molecular Formula | C19H19BrF2N2O3 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | 4-(2-bromophenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide |
| SMILES | CNC(=O)C(NC(=O)CCCOc1ccccc1Br)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19BrF2N2O3/c1-23-19(26)18(12-8-9-14(21)15(22)11-12)24-17(25)7-4-10-27-16-6-3-2-5-13(16)20/h2-3,5-6,8-9,11,18H,4,7,10H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | WZTKYGXJOCFMGE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|