C20H21ClF2N2O3 — CID 55502602
4-(4-chloro-2-methylphenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide (PubChem CID 55502602) has the molecular formula C20H21ClF2N2O3 and a molecular weight of 410.85 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 55502602 |
| Molecular Formula | C20H21ClF2N2O3 |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]butanamide |
| SMILES | CNC(=O)C(NC(=O)CCCOc1ccc(Cl)cc1C)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C20H21ClF2N2O3/c1-12-10-14(21)6-8-17(12)28-9-3-4-18(26)25-19(20(27)24-2)13-5-7-15(22)16(23)11-13/h5-8,10-11,19H,3-4,9H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | MCUXRLXMAXVYML-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|