C25H32Cl2N2O4 — CID 4125851
4-(4-chloro-2-methylphenoxy)-N-[2-[4-(4-chloro-2-methylphenoxy)butanoylamino]propyl]butanamide (PubChem CID 4125851) has the molecular formula C25H32Cl2N2O4 and a molecular weight of 495.45 g/mol. Its IUPAC name is 4-(4-chloro-2-methylphenoxy)-N-[2-[4-(4-chloro-2-methylphenoxy)butanoylamino]propyl]butanamide.
| Compound Name | 4-(4-chloro-2-methylphenoxy)-N-[2-[4-(4-chloro-2-methylphenoxy)butanoylamino]propyl]butanamide |
|---|---|
| PubChem CID | 4125851 |
| Molecular Formula | C25H32Cl2N2O4 |
| Molecular Weight | 495.45 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-(4-chloro-2-methylphenoxy)-N-[2-[4-(4-chloro-2-methylphenoxy)butanoylamino]propyl]butanamide |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NCC(C)NC(=O)CCCOc1ccc(Cl)cc1C |
| InChI | InChI=1S/C25H32Cl2N2O4/c1-17-14-20(26)8-10-22(17)32-12-4-6-24(30)28-16-19(3)29-25(31)7-5-13-33-23-11-9-21(27)15-18(23)2/h8-11,14-15,19H,4-7,12-13,16H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | BLPVNLREOSZHHL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|