C19H26ClN2O3+ — CID 8501922
[(1R)-2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-1-(furan-2-yl)ethyl]-dimethylazanium (PubChem CID 8501922) has the molecular formula C19H26ClN2O3+ and a molecular weight of 365.88 g/mol. Its IUPAC name is [(1R)-2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-1-(furan-2-yl)ethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-1-(furan-2-yl)ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 8501922 |
| Molecular Formula | C19H26ClN2O3+ |
| Molecular Weight | 365.88 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | [(1R)-2-[4-(4-chloro-2-methylphenoxy)butanoylamino]-1-(furan-2-yl)ethyl]-dimethylazanium |
| SMILES | Cc1cc(Cl)ccc1OCCCC(=O)NC[C@H](c1ccco1)[NH+](C)C |
| InChI | InChI=1S/C19H25ClN2O3/c1-14-12-15(20)8-9-17(14)24-11-5-7-19(23)21-13-16(22(2)3)18-6-4-10-25-18/h4,6,8-10,12,16H,5,7,11,13H2,1-3H3,(H,21,23)/p+1/t16-/m1/s1 |
| InChIKey | VZVDJTOTRWDKCP-MRXNPFEDSA-O |
| XLogP | 2.40 |
| TPSA | 55.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.88 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|