C16H17Cl2NO4 — CID 86850793
4-(2,3-dichlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]butanamide (PubChem CID 86850793) has the molecular formula C16H17Cl2NO4 and a molecular weight of 358.22 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]butanamide.
| Compound Name | 4-(2,3-dichlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]butanamide |
|---|---|
| PubChem CID | 86850793 |
| Molecular Formula | C16H17Cl2NO4 |
| Molecular Weight | 358.22 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-N-[2-(furan-2-yl)-2-hydroxyethyl]butanamide |
| SMILES | O=C(CCCOc1cccc(Cl)c1Cl)NCC(O)c1ccco1 |
| InChI | InChI=1S/C16H17Cl2NO4/c17-11-4-1-5-14(16(11)18)23-9-3-7-15(21)19-10-12(20)13-6-2-8-22-13/h1-2,4-6,8,12,20H,3,7,9-10H2,(H,19,21) |
| InChIKey | FOSPOCBIEQAEFM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.22 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|