C19H20Cl2N2O5 — CID 76870753
N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide (PubChem CID 76870753) has the molecular formula C19H20Cl2N2O5 and a molecular weight of 427.28 g/mol. Its IUPAC name is N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide.
| Compound Name | N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
|---|---|
| PubChem CID | 76870753 |
| Molecular Formula | C19H20Cl2N2O5 |
| Molecular Weight | 427.28 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | N-[3-(2,3-dichlorophenoxy)-2-hydroxypropyl]-3-[3-(furan-2-yl)prop-2-enoylamino]propanamide |
| SMILES | O=C(C=Cc1ccco1)NCCC(=O)NCC(O)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C19H20Cl2N2O5/c20-15-4-1-5-16(19(15)21)28-12-13(24)11-23-18(26)8-9-22-17(25)7-6-14-3-2-10-27-14/h1-7,10,13,24H,8-9,11-12H2,(H,22,25)(H,23,26) |
| InChIKey | IWZGIWSJBVOJFV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|