C17H16F2N2O4 — CID 55742167
N-[3-(difluoromethoxy)phenyl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide (PubChem CID 55742167) has the molecular formula C17H16F2N2O4 and a molecular weight of 350.32 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)phenyl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide.
| Compound Name | N-[3-(difluoromethoxy)phenyl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 55742167 |
| Molecular Formula | C17H16F2N2O4 |
| Molecular Weight | 350.32 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | N-[3-(difluoromethoxy)phenyl]-3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanamide |
| SMILES | O=C(/C=C/c1ccco1)NCCC(=O)Nc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C17H16F2N2O4/c18-17(19)25-14-4-1-3-12(11-14)21-16(23)8-9-20-15(22)7-6-13-5-2-10-24-13/h1-7,10-11,17H,8-9H2,(H,20,22)(H,21,23)/b7-6+ |
| InChIKey | NTTOXNMITWHJOP-VOTSOKGWSA-N |
| XLogP | 3.04 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|