C25H25N3O4 — CID 55899785
N-[3-[[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoylamino]methyl]phenyl]-4-methylbenzamide (PubChem CID 55899785) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is N-[3-[[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoylamino]methyl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoylamino]methyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55899785 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | N-[3-[[3-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]propanoylamino]methyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(CNC(=O)CCNC(=O)/C=C/c3ccco3)c2)cc1 |
| InChI | InChI=1S/C25H25N3O4/c1-18-7-9-20(10-8-18)25(31)28-21-5-2-4-19(16-21)17-27-24(30)13-14-26-23(29)12-11-22-6-3-15-32-22/h2-12,15-16H,13-14,17H2,1H3,(H,26,29)(H,27,30)(H,28,31)/b12-11+ |
| InChIKey | QUGOGJKEEODXJS-VAWYXSNFSA-N |
| XLogP | 3.68 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|