C11H17NO4 — CID 110899101
N-[2-(furan-2-yl)-2-hydroxyethyl]-4-methoxybutanamide (PubChem CID 110899101) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxyethyl]-4-methoxybutanamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 110899101 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxyethyl]-4-methoxybutanamide |
| SMILES | COCCCC(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C11H17NO4/c1-15-6-3-5-11(14)12-8-9(13)10-4-2-7-16-10/h2,4,7,9,13H,3,5-6,8H2,1H3,(H,12,14) |
| InChIKey | XXGKLJZNZUJEFN-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|