C11H19NO3 — CID 60969452
1-(furan-2-yl)-2-(4-methoxybutylamino)ethanol (PubChem CID 60969452) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-(4-methoxybutylamino)ethanol.
| Compound Name | 1-(furan-2-yl)-2-(4-methoxybutylamino)ethanol |
|---|---|
| PubChem CID | 60969452 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 1-(furan-2-yl)-2-(4-methoxybutylamino)ethanol |
| SMILES | COCCCCNCC(O)c1ccco1 |
| InChI | InChI=1S/C11H19NO3/c1-14-7-3-2-6-12-9-10(13)11-5-4-8-15-11/h4-5,8,10,12-13H,2-3,6-7,9H2,1H3 |
| InChIKey | QUXAMCFHNLCPQX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|