C15H19NO3 — CID 106261262
1-(furan-2-yl)-2-[2-(2-methoxyphenyl)ethylamino]ethanol (PubChem CID 106261262) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[2-(2-methoxyphenyl)ethylamino]ethanol.
| Compound Name | 1-(furan-2-yl)-2-[2-(2-methoxyphenyl)ethylamino]ethanol |
|---|---|
| PubChem CID | 106261262 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 1-(furan-2-yl)-2-[2-(2-methoxyphenyl)ethylamino]ethanol |
| SMILES | COc1ccccc1CCNCC(O)c1ccco1 |
| InChI | InChI=1S/C15H19NO3/c1-18-14-6-3-2-5-12(14)8-9-16-11-13(17)15-7-4-10-19-15/h2-7,10,13,16-17H,8-9,11H2,1H3 |
| InChIKey | WCNAWIYUDRZSKO-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|