C15H19NO4 — CID 110888253
2-[(2,5-dimethoxyphenyl)methylamino]-1-(furan-2-yl)ethanol (PubChem CID 110888253) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[(2,5-dimethoxyphenyl)methylamino]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[(2,5-dimethoxyphenyl)methylamino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 110888253 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[(2,5-dimethoxyphenyl)methylamino]-1-(furan-2-yl)ethanol |
| SMILES | COc1ccc(OC)c(CNCC(O)c2ccco2)c1 |
| InChI | InChI=1S/C15H19NO4/c1-18-12-5-6-14(19-2)11(8-12)9-16-10-13(17)15-4-3-7-20-15/h3-8,13,16-17H,9-10H2,1-2H3 |
| InChIKey | FCJDSRWWJHBRAW-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |