C12H21NO3 — CID 62564988
2-(furan-2-ylmethoxy)-N-(3-methoxypropyl)propan-1-amine (PubChem CID 62564988) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is 2-(furan-2-ylmethoxy)-N-(3-methoxypropyl)propan-1-amine.
| Compound Name | 2-(furan-2-ylmethoxy)-N-(3-methoxypropyl)propan-1-amine |
|---|---|
| PubChem CID | 62564988 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 2-(furan-2-ylmethoxy)-N-(3-methoxypropyl)propan-1-amine |
| SMILES | COCCCNCC(C)OCc1ccco1 |
| InChI | InChI=1S/C12H21NO3/c1-11(9-13-6-4-7-14-2)16-10-12-5-3-8-15-12/h3,5,8,11,13H,4,6-7,9-10H2,1-2H3 |
| InChIKey | QPTAIGRGLHWYGP-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|