C13H24N2O2 — CID 62569524
2-N-(furan-2-ylmethyl)-1-N-(3-methoxypropyl)-2-N-methylpropane-1,2-diamine (PubChem CID 62569524) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-N-(furan-2-ylmethyl)-1-N-(3-methoxypropyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 2-N-(furan-2-ylmethyl)-1-N-(3-methoxypropyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 62569524 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 2-N-(furan-2-ylmethyl)-1-N-(3-methoxypropyl)-2-N-methylpropane-1,2-diamine |
| SMILES | COCCCNCC(C)N(C)Cc1ccco1 |
| InChI | InChI=1S/C13H24N2O2/c1-12(10-14-7-5-8-16-3)15(2)11-13-6-4-9-17-13/h4,6,9,12,14H,5,7-8,10-11H2,1-3H3 |
| InChIKey | NWBSDEXLBMINCZ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|