C18H21NO4 — CID 110889375
4-(4-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]-4-oxobutanamide (PubChem CID 110889375) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is 4-(4-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]-4-oxobutanamide.
| Compound Name | 4-(4-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110889375 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 4-(4-ethylphenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]-4-oxobutanamide |
| SMILES | CCc1ccc(C(=O)CCC(=O)NCC(O)c2ccco2)cc1 |
| InChI | InChI=1S/C18H21NO4/c1-2-13-5-7-14(8-6-13)15(20)9-10-18(22)19-12-16(21)17-4-3-11-23-17/h3-8,11,16,21H,2,9-10,12H2,1H3,(H,19,22) |
| InChIKey | HNXZYDPWOXPMPL-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |