C13H20N2O4 — CID 111102313
N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]pentanediamide (PubChem CID 111102313) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]pentanediamide.
| Compound Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]pentanediamide |
|---|---|
| PubChem CID | 111102313 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-ethyl-N'-[2-(furan-2-yl)-2-hydroxyethyl]pentanediamide |
| SMILES | CCNC(=O)CCCC(=O)NCC(O)c1ccco1 |
| InChI | InChI=1S/C13H20N2O4/c1-2-14-12(17)6-3-7-13(18)15-9-10(16)11-5-4-8-19-11/h4-5,8,10,16H,2-3,6-7,9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | GJUHIQFEGOBPAQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |