C15H16BrNO3 — CID 110889052
3-(3-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]propanamide (PubChem CID 110889052) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is 3-(3-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]propanamide.
| Compound Name | 3-(3-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]propanamide |
|---|---|
| PubChem CID | 110889052 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 3-(3-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]propanamide |
| SMILES | O=C(CCc1cccc(Br)c1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C15H16BrNO3/c16-12-4-1-3-11(9-12)6-7-15(19)17-10-13(18)14-5-2-8-20-14/h1-5,8-9,13,18H,6-7,10H2,(H,17,19) |
| InChIKey | OYJFTZRQDCLZGH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |