C17H20BrNO3 — CID 87016967
5-(4-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]pentanamide (PubChem CID 87016967) has the molecular formula C17H20BrNO3 and a molecular weight of 366.25 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]pentanamide.
| Compound Name | 5-(4-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]pentanamide |
|---|---|
| PubChem CID | 87016967 |
| Molecular Formula | C17H20BrNO3 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 5-(4-bromophenyl)-N-[2-(furan-2-yl)-2-hydroxyethyl]pentanamide |
| SMILES | O=C(CCCCc1ccc(Br)cc1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C17H20BrNO3/c18-14-9-7-13(8-10-14)4-1-2-6-17(21)19-12-15(20)16-5-3-11-22-16/h3,5,7-11,15,20H,1-2,4,6,12H2,(H,19,21) |
| InChIKey | BBOJDTDICSPVQG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|