C16H24N2O4 — CID 110921907
N-[3-[[2-(furan-2-yl)-2-hydroxyethyl]amino]-3-oxopropyl]cyclohexanecarboxamide (PubChem CID 110921907) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[3-[[2-(furan-2-yl)-2-hydroxyethyl]amino]-3-oxopropyl]cyclohexanecarboxamide.
| Compound Name | N-[3-[[2-(furan-2-yl)-2-hydroxyethyl]amino]-3-oxopropyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 110921907 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | N-[3-[[2-(furan-2-yl)-2-hydroxyethyl]amino]-3-oxopropyl]cyclohexanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCCC1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C16H24N2O4/c19-13(14-7-4-10-22-14)11-18-15(20)8-9-17-16(21)12-5-2-1-3-6-12/h4,7,10,12-13,19H,1-3,5-6,8-9,11H2,(H,17,21)(H,18,20) |
| InChIKey | RUBMBQWCIBAZGO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |