C16H19ClN2O4 — CID 111508519
1-[2-(2-chlorophenoxy)propyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 111508519) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)propyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-[2-(2-chlorophenoxy)propyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 111508519 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)propyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | CC(CNC(=O)NCC(O)c1ccco1)Oc1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN2O4/c1-11(23-14-6-3-2-5-12(14)17)9-18-16(21)19-10-13(20)15-7-4-8-22-15/h2-8,11,13,20H,9-10H2,1H3,(H2,18,19,21) |
| InChIKey | KNXLLFKEMWRTIM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |