C18H31N3O3 — CID 110895654
1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea (PubChem CID 110895654) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea.
| Compound Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
|---|---|
| PubChem CID | 110895654 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | 1-[2-(azepan-1-yl)-3-methylbutyl]-3-[2-(furan-2-yl)-2-hydroxyethyl]urea |
| SMILES | CC(C)C(CNC(=O)NCC(O)c1ccco1)N1CCCCCC1 |
| InChI | InChI=1S/C18H31N3O3/c1-14(2)15(21-9-5-3-4-6-10-21)12-19-18(23)20-13-16(22)17-8-7-11-24-17/h7-8,11,14-16,22H,3-6,9-10,12-13H2,1-2H3,(H2,19,20,23) |
| InChIKey | YSFYUTMAQQLMMN-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |