C15H25N3O3 — CID 110896232
1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-pyrrolidin-1-ylbutyl)urea (PubChem CID 110896232) has the molecular formula C15H25N3O3 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-pyrrolidin-1-ylbutyl)urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-pyrrolidin-1-ylbutyl)urea |
|---|---|
| PubChem CID | 110896232 |
| Molecular Formula | C15H25N3O3 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxyethyl]-3-(4-pyrrolidin-1-ylbutyl)urea |
| SMILES | O=C(NCCCCN1CCCC1)NCC(O)c1ccco1 |
| InChI | InChI=1S/C15H25N3O3/c19-13(14-6-5-11-21-14)12-17-15(20)16-7-1-2-8-18-9-3-4-10-18/h5-6,11,13,19H,1-4,7-10,12H2,(H2,16,17,20) |
| InChIKey | IYHDYBDUFAZGRH-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|