C14H20Cl2N2O2 — CID 119508138
4-(2,3-dichlorophenoxy)-N-[2-(ethylamino)ethyl]butanamide (PubChem CID 119508138) has the molecular formula C14H20Cl2N2O2 and a molecular weight of 319.23 g/mol. Its IUPAC name is 4-(2,3-dichlorophenoxy)-N-[2-(ethylamino)ethyl]butanamide.
| Compound Name | 4-(2,3-dichlorophenoxy)-N-[2-(ethylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 119508138 |
| Molecular Formula | C14H20Cl2N2O2 |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(2,3-dichlorophenoxy)-N-[2-(ethylamino)ethyl]butanamide |
| SMILES | CCNCCNC(=O)CCCOc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H20Cl2N2O2/c1-2-17-8-9-18-13(19)7-4-10-20-12-6-3-5-11(15)14(12)16/h3,5-6,17H,2,4,7-10H2,1H3,(H,18,19) |
| InChIKey | WFRZMSIBHYXSNX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|