C18H15BrF2N2O2 — CID 78841511
(E)-3-(2-bromophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 78841511) has the molecular formula C18H15BrF2N2O2 and a molecular weight of 409.23 g/mol. Its IUPAC name is (E)-3-(2-bromophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(2-bromophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78841511 |
| Molecular Formula | C18H15BrF2N2O2 |
| Molecular Weight | 409.23 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | (E)-3-(2-bromophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CNC(=O)C(NC(=O)/C=C/c1ccccc1Br)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H15BrF2N2O2/c1-22-18(25)17(12-6-8-14(20)15(21)10-12)23-16(24)9-7-11-4-2-3-5-13(11)19/h2-10,17H,1H3,(H,22,25)(H,23,24)/b9-7+ |
| InChIKey | XARSVDBVDDXQAR-VQHVLOKHSA-N |
| XLogP | 3.34 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.23 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|