C16H13F2NO4 — CID 127264815
2-(3,4-difluorophenyl)-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]acetic acid (PubChem CID 127264815) has the molecular formula C16H13F2NO4 and a molecular weight of 321.28 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]acetic acid.
| Compound Name | 2-(3,4-difluorophenyl)-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]acetic acid |
|---|---|
| PubChem CID | 127264815 |
| Molecular Formula | C16H13F2NO4 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-(3,4-difluorophenyl)-2-[3-(5-methylfuran-2-yl)prop-2-enoylamino]acetic acid |
| SMILES | Cc1ccc(C=CC(=O)NC(C(=O)O)c2ccc(F)c(F)c2)o1 |
| InChI | InChI=1S/C16H13F2NO4/c1-9-2-4-11(23-9)5-7-14(20)19-15(16(21)22)10-3-6-12(17)13(18)8-10/h2-8,15H,1H3,(H,19,20)(H,21,22) |
| InChIKey | RTOMQDNCOAPQOX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|