C12H15NO5 — CID 113355780
methyl (2S)-3-hydroxy-2-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]propanoate (PubChem CID 113355780) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is methyl (2S)-3-hydroxy-2-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]propanoate.
| Compound Name | methyl (2S)-3-hydroxy-2-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 113355780 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | methyl (2S)-3-hydroxy-2-[[(E)-3-(5-methylfuran-2-yl)prop-2-enoyl]amino]propanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)/C=C/c1ccc(C)o1 |
| InChI | InChI=1S/C12H15NO5/c1-8-3-4-9(18-8)5-6-11(15)13-10(7-14)12(16)17-2/h3-6,10,14H,7H2,1-2H3,(H,13,15)/b6-5+/t10-/m0/s1 |
| InChIKey | MOFSZJHUZNTWQC-PORFMDCZSA-N |
| XLogP | 0.25 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|