C18H14Cl2F2N2O2 — CID 78841512
(E)-3-(2,6-dichlorophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide (PubChem CID 78841512) has the molecular formula C18H14Cl2F2N2O2 and a molecular weight of 399.22 g/mol. Its IUPAC name is (E)-3-(2,6-dichlorophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide.
| Compound Name | (E)-3-(2,6-dichlorophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide |
|---|---|
| PubChem CID | 78841512 |
| Molecular Formula | C18H14Cl2F2N2O2 |
| Molecular Weight | 399.22 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | (E)-3-(2,6-dichlorophenyl)-N-[1-(3,4-difluorophenyl)-2-(methylamino)-2-oxoethyl]prop-2-enamide |
| SMILES | CNC(=O)C(NC(=O)/C=C/c1c(Cl)cccc1Cl)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C18H14Cl2F2N2O2/c1-23-18(26)17(10-5-7-14(21)15(22)9-10)24-16(25)8-6-11-12(19)3-2-4-13(11)20/h2-9,17H,1H3,(H,23,26)(H,24,25)/b8-6+ |
| InChIKey | CJWYCHOZHVQPEM-SOFGYWHQSA-N |
| XLogP | 3.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|