C28H40BN3O6 — CID 158525934
[(1R)-1-[[(2S)-2-[(4-butylbenzoyl)amino]-4-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 158525934) has the molecular formula C28H40BN3O6 and a molecular weight of 525.46 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[(4-butylbenzoyl)amino]-4-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[(4-butylbenzoyl)amino]-4-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 158525934 |
| Molecular Formula | C28H40BN3O6 |
| Molecular Weight | 525.46 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[(4-butylbenzoyl)amino]-4-(phenylmethoxycarbonylamino)butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCc1ccc(C(=O)N[C@@H](CCNC(=O)OCc2ccccc2)C(=O)N[C@@H](CC(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C28H40BN3O6/c1-4-5-9-21-12-14-23(15-13-21)26(33)31-24(27(34)32-25(29(36)37)18-20(2)3)16-17-30-28(35)38-19-22-10-7-6-8-11-22/h6-8,10-15,20,24-25,36-37H,4-5,9,16-19H2,1-3H3,(H,30,35)(H,31,33)(H,32,34)/t24-,25-/m0/s1 |
| InChIKey | HMTXVWBRLPOQIE-DQEYMECFSA-N |
| XLogP | 2.99 |
| TPSA | 136.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.46 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|