C23H30BNO5 — CID 58301733
[(1R)-1-[[(2S)-2-[(1R)-1-hydroxyethyl]-4-oxo-4-(4-phenylphenyl)butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301733) has the molecular formula C23H30BNO5 and a molecular weight of 411.31 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[(1R)-1-hydroxyethyl]-4-oxo-4-(4-phenylphenyl)butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[(1R)-1-hydroxyethyl]-4-oxo-4-(4-phenylphenyl)butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301733 |
| Molecular Formula | C23H30BNO5 |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[(1R)-1-hydroxyethyl]-4-oxo-4-(4-phenylphenyl)butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)c1ccc(-c2ccccc2)cc1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C23H30BNO5/c1-15(2)13-22(24(29)30)25-23(28)20(16(3)26)14-21(27)19-11-9-18(10-12-19)17-7-5-4-6-8-17/h4-12,15-16,20,22,26,29-30H,13-14H2,1-3H3,(H,25,28)/t16-,20+,22+/m1/s1 |
| InChIKey | NTONFSKSCHWAPU-BUVFEPMLSA-N |
| XLogP | 2.47 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|