C23H29BFNO5 — CID 58301938
[(1R)-1-[[(2S)-4-[4-(2-fluorophenyl)phenyl]-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301938) has the molecular formula C23H29BFNO5 and a molecular weight of 429.30 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-4-[4-(2-fluorophenyl)phenyl]-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-4-[4-(2-fluorophenyl)phenyl]-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301938 |
| Molecular Formula | C23H29BFNO5 |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | [(1R)-1-[[(2S)-4-[4-(2-fluorophenyl)phenyl]-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)c1ccc(-c2ccccc2F)cc1)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C23H29BFNO5/c1-14(2)12-22(24(30)31)26-23(29)19(15(3)27)13-21(28)17-10-8-16(9-11-17)18-6-4-5-7-20(18)25/h4-11,14-15,19,22,27,30-31H,12-13H2,1-3H3,(H,26,29)/t15-,19+,22+/m1/s1 |
| InChIKey | LNFCDYAEWCECDF-MPHOGZCYSA-N |
| XLogP | 2.61 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|