C23H28BCl2NO5 — CID 162189846
[(1R)-1-[[(2S)-4-(2,5-dichloro-3-phenylphenyl)-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 162189846) has the molecular formula C23H28BCl2NO5 and a molecular weight of 480.20 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-4-(2,5-dichloro-3-phenylphenyl)-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-4-(2,5-dichloro-3-phenylphenyl)-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 162189846 |
| Molecular Formula | C23H28BCl2NO5 |
| Molecular Weight | 480.20 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | [(1R)-1-[[(2S)-4-(2,5-dichloro-3-phenylphenyl)-2-[(1R)-1-hydroxyethyl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)c1cc(Cl)cc(-c2ccccc2)c1Cl)[C@@H](C)O)B(O)O |
| InChI | InChI=1S/C23H28BCl2NO5/c1-13(2)9-21(24(31)32)27-23(30)17(14(3)28)12-20(29)19-11-16(25)10-18(22(19)26)15-7-5-4-6-8-15/h4-8,10-11,13-14,17,21,28,31-32H,9,12H2,1-3H3,(H,27,30)/t14-,17+,21+/m1/s1 |
| InChIKey | ZHRDAKWWZUXHBF-FNXXIHLHSA-N |
| XLogP | 3.77 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.20 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|