C25H31BN2O6 — CID 165382056
[(1R)-1-[[(2S)-2-[[2-(9H-fluoren-9-yl)acetyl]amino]-4-methoxy-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 165382056) has the molecular formula C25H31BN2O6 and a molecular weight of 466.34 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[2-(9H-fluoren-9-yl)acetyl]amino]-4-methoxy-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[2-(9H-fluoren-9-yl)acetyl]amino]-4-methoxy-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 165382056 |
| Molecular Formula | C25H31BN2O6 |
| Molecular Weight | 466.34 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[2-(9H-fluoren-9-yl)acetyl]amino]-4-methoxy-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | COC(=O)C[C@H](NC(=O)CC1c2ccccc2-c2ccccc21)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C25H31BN2O6/c1-15(2)12-22(26(32)33)28-25(31)21(14-24(30)34-3)27-23(29)13-20-18-10-6-4-8-16(18)17-9-5-7-11-19(17)20/h4-11,15,20-22,32-33H,12-14H2,1-3H3,(H,27,29)(H,28,31)/t21-,22-/m0/s1 |
| InChIKey | HUWPCNKWPKJDOJ-VXKWHMMOSA-N |
| XLogP | 1.78 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|