C18H16O4 — CID 102547292
2-(9H-fluoren-9-yl)-4-methoxy-4-oxobutanoic acid (PubChem CID 102547292) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is 2-(9H-fluoren-9-yl)-4-methoxy-4-oxobutanoic acid.
| Compound Name | 2-(9H-fluoren-9-yl)-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 102547292 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 2-(9H-fluoren-9-yl)-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)CC(C(=O)O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H16O4/c1-22-16(19)10-15(18(20)21)17-13-8-4-2-6-11(13)12-7-3-5-9-14(12)17/h2-9,15,17H,10H2,1H3,(H,20,21) |
| InChIKey | OGHNHKIYMZIMGI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |