C23H34BN3O4 — CID 58301576
[(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-(pyrazol-1-ylmethyl)butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301576) has the molecular formula C23H34BN3O4 and a molecular weight of 427.35 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-(pyrazol-1-ylmethyl)butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-(pyrazol-1-ylmethyl)butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301576 |
| Molecular Formula | C23H34BN3O4 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-(pyrazol-1-ylmethyl)butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCc1ccc(C(=O)C[C@@H](Cn2cccn2)C(=O)N[C@@H](CC(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C23H34BN3O4/c1-4-5-7-18-8-10-19(11-9-18)21(28)15-20(16-27-13-6-12-25-27)23(29)26-22(24(30)31)14-17(2)3/h6,8-13,17,20,22,30-31H,4-5,7,14-16H2,1-3H3,(H,26,29)/t20-,22-/m0/s1 |
| InChIKey | FYLXFJLWZLHGSG-UNMCSNQZSA-N |
| XLogP | 2.66 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|