C25H42BN3O5 — CID 58301607
[(1R)-3-methyl-1-[[(2S)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]tridecanoyl]amino]butyl]boronic acid (PubChem CID 58301607) has the molecular formula C25H42BN3O5 and a molecular weight of 475.44 g/mol. Its IUPAC name is [(1R)-3-methyl-1-[[(2S)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]tridecanoyl]amino]butyl]boronic acid.
| Compound Name | [(1R)-3-methyl-1-[[(2S)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]tridecanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 58301607 |
| Molecular Formula | C25H42BN3O5 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | [(1R)-3-methyl-1-[[(2S)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]tridecanoyl]amino]butyl]boronic acid |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CNC(=O)c1cccnc1)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C25H42BN3O5/c1-4-5-6-7-8-9-10-13-22(30)16-21(18-28-24(31)20-12-11-14-27-17-20)25(32)29-23(26(33)34)15-19(2)3/h11-12,14,17,19,21,23,33-34H,4-10,13,15-16,18H2,1-3H3,(H,28,31)(H,29,32)/t21-,23-/m0/s1 |
| InChIKey | UJXGPFPPGQSUCI-GMAHTHKFSA-N |
| XLogP | 3.07 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|