C26H36BN3O5 — CID 159930299
[(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]butanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 159930299) has the molecular formula C26H36BN3O5 and a molecular weight of 481.40 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]butanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]butanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 159930299 |
| Molecular Formula | C26H36BN3O5 |
| Molecular Weight | 481.40 g/mol |
| Exact Mass | 481.27 |
| IUPAC Name | [(1R)-1-[[(2S)-4-(4-butylphenyl)-4-oxo-2-[(pyridine-3-carbonylamino)methyl]butanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCc1ccc(C(=O)C[C@@H](CNC(=O)c2cccnc2)C(=O)N[C@@H](CC(C)C)B(O)O)cc1 |
| InChI | InChI=1S/C26H36BN3O5/c1-4-5-7-19-9-11-20(12-10-19)23(31)15-22(17-29-25(32)21-8-6-13-28-16-21)26(33)30-24(27(34)35)14-18(2)3/h6,8-13,16,18,22,24,34-35H,4-5,7,14-15,17H2,1-3H3,(H,29,32)(H,30,33)/t22-,24-/m0/s1 |
| InChIKey | NZNYWNPKQNUCOL-UPVQGACJSA-N |
| XLogP | 2.59 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.40 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|