C25H42BFN2O6S — CID 58301815
[(1R)-1-[[(2S)-2-[[(4-fluorophenyl)sulfonylamino]methyl]-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 58301815) has the molecular formula C25H42BFN2O6S and a molecular weight of 528.50 g/mol. Its IUPAC name is [(1R)-1-[[(2S)-2-[[(4-fluorophenyl)sulfonylamino]methyl]-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[(2S)-2-[[(4-fluorophenyl)sulfonylamino]methyl]-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 58301815 |
| Molecular Formula | C25H42BFN2O6S |
| Molecular Weight | 528.50 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | [(1R)-1-[[(2S)-2-[[(4-fluorophenyl)sulfonylamino]methyl]-4-oxotridecanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CCCCCCCCCC(=O)C[C@@H](CNS(=O)(=O)c1ccc(F)cc1)C(=O)N[C@@H](CC(C)C)B(O)O |
| InChI | InChI=1S/C25H42BFN2O6S/c1-4-5-6-7-8-9-10-11-22(30)17-20(25(31)29-24(26(32)33)16-19(2)3)18-28-36(34,35)23-14-12-21(27)13-15-23/h12-15,19-20,24,28,32-33H,4-11,16-18H2,1-3H3,(H,29,31)/t20-,24-/m0/s1 |
| InChIKey | VFHNKCKLQJMBFR-RDPSFJRHSA-N |
| XLogP | 3.36 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|